C9H9F3N4O — CID 60891927
4-N-methyl-4-N-(2,2,2-trifluoroethyl)-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 60891927) has the molecular formula C9H9F3N4O and a molecular weight of 246.19 g/mol. Its IUPAC name is 4-N-methyl-4-N-(2,2,2-trifluoroethyl)-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-methyl-4-N-(2,2,2-trifluoroethyl)-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 60891927 |
| Molecular Formula | C9H9F3N4O |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-N-methyl-4-N-(2,2,2-trifluoroethyl)-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | CN(CC(F)(F)F)c1ccc(N)c2nonc12 |
| InChI | InChI=1S/C9H9F3N4O/c1-16(4-9(10,11)12)6-3-2-5(13)7-8(6)15-17-14-7/h2-3H,4,13H2,1H3 |
| InChIKey | BCSMQOSNVGJQRY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|