About 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone
2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone (PubChem CID 60891968) has the molecular formula C9H10F3N3O3
and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone |
| PubChem CID | 60891968 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone |
| SMILES | CN(CC(=O)c1cc([N+](=O)[O-])c[nH]1)CC(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O3/c1-14(5-9(10,11)12)4-8(16)7-2-6(3-13-7)15(17)18/h2-3,13H,4-5H2,1H3 |
| InChIKey | QRHHGIMWALRLDP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone?
The IUPAC name of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone (CID 60891968) is 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone.
What is the SMILES notation for 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone?
The canonical SMILES for 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone is CN(CC(=O)c1cc([N+](=O)[O-])c[nH]1)CC(F)(F)F.
What is the InChIKey of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone?
The InChIKey is QRHHGIMWALRLDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N3O3/c1-14(5-9(10,11)12)4-8(16)7-2-6(3-13-7)15(17)18/h2-3,13H,4-5H2,1H3.
What are the key properties of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone?
2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone has a molecular weight of 265.19 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(4-nitro-1H-pyrrol-2-yl)ethanone is sourced from PubChem (CID 60891968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).