C6H9F3N2OS — CID 60891970
3-amino-N-methyl-3-sulfanylidene-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 60891970) has the molecular formula C6H9F3N2OS and a molecular weight of 214.21 g/mol. Its IUPAC name is 3-amino-N-methyl-3-sulfanylidene-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-amino-N-methyl-3-sulfanylidene-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 60891970 |
| Molecular Formula | C6H9F3N2OS |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-amino-N-methyl-3-sulfanylidene-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CN(CC(F)(F)F)C(=O)CC(N)=S |
| InChI | InChI=1S/C6H9F3N2OS/c1-11(3-6(7,8)9)5(12)2-4(10)13/h2-3H2,1H3,(H2,10,13) |
| InChIKey | CZJRVNPZQWFZOI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|