C11H12O3S — CID 60892207
3,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-4-one (PubChem CID 60892207) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-4-one.
| Compound Name | 3,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 60892207 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 3,8-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| SMILES | Cc1cccc2c1S(=O)(=O)CC(C)C2=O |
| InChI | InChI=1S/C11H12O3S/c1-7-4-3-5-9-10(12)8(2)6-15(13,14)11(7)9/h3-5,8H,6H2,1-2H3 |
| InChIKey | BVTPGTPTXJNXQV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |