C11H15F3N2O — CID 60892311
2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethoxy]aniline (PubChem CID 60892311) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethoxy]aniline.
| Compound Name | 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethoxy]aniline |
|---|---|
| PubChem CID | 60892311 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethoxy]aniline |
| SMILES | CN(CCOc1ccccc1N)CC(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O/c1-16(8-11(12,13)14)6-7-17-10-5-3-2-4-9(10)15/h2-5H,6-8,15H2,1H3 |
| InChIKey | ORDKZNNQQONCCQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|