C8H9F3N2O4 — CID 60892369
(E)-4-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]-4-oxobut-2-enoic acid (PubChem CID 60892369) has the molecular formula C8H9F3N2O4 and a molecular weight of 254.16 g/mol. Its IUPAC name is (E)-4-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 60892369 |
| Molecular Formula | C8H9F3N2O4 |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (E)-4-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CN(CC(F)(F)F)C(=O)NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C8H9F3N2O4/c1-13(4-8(9,10)11)7(17)12-5(14)2-3-6(15)16/h2-3H,4H2,1H3,(H,15,16)(H,12,14,17)/b3-2+ |
| InChIKey | ZGRRKKMLDARCNC-NSCUHMNNSA-N |
| XLogP | 0.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|