C10H13F3N2O3S — CID 60893077
3-amino-4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60893077) has the molecular formula C10H13F3N2O3S and a molecular weight of 298.29 g/mol. Its IUPAC name is 3-amino-4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 3-amino-4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60893077 |
| Molecular Formula | C10H13F3N2O3S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-amino-4-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(F)(F)F)cc1N |
| InChI | InChI=1S/C10H13F3N2O3S/c1-15(6-10(11,12)13)19(16,17)7-3-4-9(18-2)8(14)5-7/h3-5H,6,14H2,1-2H3 |
| InChIKey | ZIZUHUATUIWMIN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|