C7H8ClF3N2S — CID 60893134
4-(chloromethyl)-N-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine (PubChem CID 60893134) has the molecular formula C7H8ClF3N2S and a molecular weight of 244.67 g/mol. Its IUPAC name is 4-(chloromethyl)-N-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(chloromethyl)-N-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60893134 |
| Molecular Formula | C7H8ClF3N2S |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 4-(chloromethyl)-N-methyl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
| SMILES | CN(CC(F)(F)F)c1nc(CCl)cs1 |
| InChI | InChI=1S/C7H8ClF3N2S/c1-13(4-7(9,10)11)6-12-5(2-8)3-14-6/h3H,2,4H2,1H3 |
| InChIKey | PAWKUEHELUICII-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|