C14H7F4NO2S — CID 608932
1-oxido-2-[(4,5,6,7-tetrafluoro-1-benzofuran-2-yl)methylsulfanyl]pyridin-1-ium (PubChem CID 608932) has the molecular formula C14H7F4NO2S and a molecular weight of 329.27 g/mol. Its IUPAC name is 1-oxido-2-[(4,5,6,7-tetrafluoro-1-benzofuran-2-yl)methylsulfanyl]pyridin-1-ium.
| Compound Name | 1-oxido-2-[(4,5,6,7-tetrafluoro-1-benzofuran-2-yl)methylsulfanyl]pyridin-1-ium |
|---|---|
| PubChem CID | 608932 |
| Molecular Formula | C14H7F4NO2S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 1-oxido-2-[(4,5,6,7-tetrafluoro-1-benzofuran-2-yl)methylsulfanyl]pyridin-1-ium |
| SMILES | [O-][n+]1ccccc1SCc1cc2c(F)c(F)c(F)c(F)c2o1 |
| InChI | InChI=1S/C14H7F4NO2S/c15-10-8-5-7(6-22-9-3-1-2-4-19(9)20)21-14(8)13(18)12(17)11(10)16/h1-5H,6H2 |
| InChIKey | RSNVDBGQYHIIGA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|