C14H31N3 — CID 60893438
N'-[1-(1-propylpiperidin-4-yl)ethyl]butane-1,4-diamine (PubChem CID 60893438) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is N'-[1-(1-propylpiperidin-4-yl)ethyl]butane-1,4-diamine.
| Compound Name | N'-[1-(1-propylpiperidin-4-yl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 60893438 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | N'-[1-(1-propylpiperidin-4-yl)ethyl]butane-1,4-diamine |
| SMILES | CCCN1CCC(C(C)NCCCCN)CC1 |
| InChI | InChI=1S/C14H31N3/c1-3-10-17-11-6-14(7-12-17)13(2)16-9-5-4-8-15/h13-14,16H,3-12,15H2,1-2H3 |
| InChIKey | LQMVONNDXBUPQY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|