C11H24N2O2S — CID 60894219
3-(aminomethyl)-N,N-bis(2-methoxyethyl)thiolan-3-amine (PubChem CID 60894219) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-bis(2-methoxyethyl)thiolan-3-amine.
| Compound Name | 3-(aminomethyl)-N,N-bis(2-methoxyethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 60894219 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 3-(aminomethyl)-N,N-bis(2-methoxyethyl)thiolan-3-amine |
| SMILES | COCCN(CCOC)C1(CN)CCSC1 |
| InChI | InChI=1S/C11H24N2O2S/c1-14-6-4-13(5-7-15-2)11(9-12)3-8-16-10-11/h3-10,12H2,1-2H3 |
| InChIKey | HSYOAHPNGWNNSR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |