C13H17N3O4 — CID 60895921
ethyl 2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]acetate (PubChem CID 60895921) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 60895921 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | ethyl 2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H17N3O4/c1-2-20-12(18)8-15-11(17)7-16-13(19)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,17)(H,16,19) |
| InChIKey | DQCBCMGQSCKAJE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|