About 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol
1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 60896376) has the molecular formula C12H12F3N3O2S
and a molecular weight of 319.31 g/mol. Its IUPAC name is 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol.
Molecular Properties
| Compound Name | 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol |
| PubChem CID | 60896376 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | OC(CNc1ccc(C(F)(F)F)cc1)COc1cnsn1 |
| InChI | InChI=1S/C12H12F3N3O2S/c13-12(14,15)8-1-3-9(4-2-8)16-5-10(19)7-20-11-6-17-21-18-11/h1-4,6,10,16,19H,5,7H2 |
| InChIKey | DQVBIRCWGVDRGR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol?
The IUPAC name of 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol (CID 60896376) is 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol.
What is the SMILES notation for 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol?
The canonical SMILES for 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol is OC(CNc1ccc(C(F)(F)F)cc1)COc1cnsn1.
What is the InChIKey of 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol?
The InChIKey is DQVBIRCWGVDRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N3O2S/c13-12(14,15)8-1-3-9(4-2-8)16-5-10(19)7-20-11-6-17-21-18-11/h1-4,6,10,16,19H,5,7H2.
What are the key properties of 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol?
1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol has a molecular weight of 319.31 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,5-thiadiazol-3-yloxy)-3-[4-(trifluoromethyl)anilino]propan-2-ol is sourced from PubChem (CID 60896376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).