C14H17F2NO3 — CID 60896395
1-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexan-1-ol (PubChem CID 60896395) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 60896395 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexan-1-ol |
| SMILES | OC1(CNc2ccc3c(c2)OC(F)(F)O3)CCCCC1 |
| InChI | InChI=1S/C14H17F2NO3/c15-14(16)19-11-5-4-10(8-12(11)20-14)17-9-13(18)6-2-1-3-7-13/h4-5,8,17-18H,1-3,6-7,9H2 |
| InChIKey | VHFKPLNDTPULJS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|