C14H7F2NO3S — CID 6089668
(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6089668) has the molecular formula C14H7F2NO3S and a molecular weight of 307.28 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6089668 |
| Molecular Formula | C14H7F2NO3S |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(-c3ccc(F)cc3F)o2)S1 |
| InChI | InChI=1S/C14H7F2NO3S/c15-7-1-3-9(10(16)5-7)11-4-2-8(20-11)6-12-13(18)17-14(19)21-12/h1-6H,(H,17,18,19)/b12-6- |
| InChIKey | FWEPNYNOKOHTNJ-SDQBBNPISA-N |
| XLogP | 3.55 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|