About 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol
1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol (PubChem CID 60896779) has the molecular formula C17H17F2NO
and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol |
| PubChem CID | 60896779 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol |
| SMILES | OC(CNc1ccc2c(c1)CCC2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H17F2NO/c18-15-7-5-13(9-16(15)19)17(21)10-20-14-6-4-11-2-1-3-12(11)8-14/h4-9,17,20-21H,1-3,10H2 |
| InChIKey | FKFJXJITMGQIOS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol?
The IUPAC name of 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol (CID 60896779) is 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol.
What is the SMILES notation for 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol?
The canonical SMILES for 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol is OC(CNc1ccc2c(c1)CCC2)c1ccc(F)c(F)c1.
What is the InChIKey of 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol?
The InChIKey is FKFJXJITMGQIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO/c18-15-7-5-13(9-16(15)19)17(21)10-20-14-6-4-11-2-1-3-12(11)8-14/h4-9,17,20-21H,1-3,10H2.
What are the key properties of 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol?
1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol has a molecular weight of 289.33 g/mol, XLogP of 3.60, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-5-ylamino)ethanol is sourced from PubChem (CID 60896779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).