C16H19NO3S — CID 60898004
2-[(1,1-dioxothiolan-3-yl)amino]-1-naphthalen-2-ylethanol (PubChem CID 60898004) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]-1-naphthalen-2-ylethanol.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]-1-naphthalen-2-ylethanol |
|---|---|
| PubChem CID | 60898004 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]-1-naphthalen-2-ylethanol |
| SMILES | O=S1(=O)CCC(NCC(O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C16H19NO3S/c18-16(10-17-15-7-8-21(19,20)11-15)14-6-5-12-3-1-2-4-13(12)9-14/h1-6,9,15-18H,7-8,10-11H2 |
| InChIKey | IGOHUYXIOGPMAW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |