C11H11Cl2N3O2S — CID 60898964
1-(2,5-dichloroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol (PubChem CID 60898964) has the molecular formula C11H11Cl2N3O2S and a molecular weight of 320.20 g/mol. Its IUPAC name is 1-(2,5-dichloroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol.
| Compound Name | 1-(2,5-dichloroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 60898964 |
| Molecular Formula | C11H11Cl2N3O2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 1-(2,5-dichloroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
| SMILES | OC(CNc1cc(Cl)ccc1Cl)COc1cnsn1 |
| InChI | InChI=1S/C11H11Cl2N3O2S/c12-7-1-2-9(13)10(3-7)14-4-8(17)6-18-11-5-15-19-16-11/h1-3,5,8,14,17H,4,6H2 |
| InChIKey | BLSHSVGZCLHCJX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |