C19H26N2 — CID 60903436
1-(4-butylphenyl)-N-(2-pyridin-4-ylethyl)ethanamine (PubChem CID 60903436) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(4-butylphenyl)-N-(2-pyridin-4-ylethyl)ethanamine.
| Compound Name | 1-(4-butylphenyl)-N-(2-pyridin-4-ylethyl)ethanamine |
|---|---|
| PubChem CID | 60903436 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(4-butylphenyl)-N-(2-pyridin-4-ylethyl)ethanamine |
| SMILES | CCCCc1ccc(C(C)NCCc2ccncc2)cc1 |
| InChI | InChI=1S/C19H26N2/c1-3-4-5-17-6-8-19(9-7-17)16(2)21-15-12-18-10-13-20-14-11-18/h6-11,13-14,16,21H,3-5,12,15H2,1-2H3 |
| InChIKey | JZAHZOSSGZMGSO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |