C14H16N2 — CID 60903784
2-N-[(2-methylphenyl)methyl]benzene-1,2-diamine (PubChem CID 60903784) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-N-[(2-methylphenyl)methyl]benzene-1,2-diamine.
| Compound Name | 2-N-[(2-methylphenyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 60903784 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-N-[(2-methylphenyl)methyl]benzene-1,2-diamine |
| SMILES | Cc1ccccc1CNc1ccccc1N |
| InChI | InChI=1S/C14H16N2/c1-11-6-2-3-7-12(11)10-16-14-9-5-4-8-13(14)15/h2-9,16H,10,15H2,1H3 |
| InChIKey | MHGXYBDXVPPMGS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|