C21H17N3O5 — CID 6090733
2-[2-methoxy-6-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 6090733) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is 2-[2-methoxy-6-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-methoxy-6-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 6090733 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[2-methoxy-6-[(E)-[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | COc1cccc(/C=C2\C(=O)NC(=O)N(c3ccc(C)cc3)C2=O)c1OCC#N |
| InChI | InChI=1S/C21H17N3O5/c1-13-6-8-15(9-7-13)24-20(26)16(19(25)23-21(24)27)12-14-4-3-5-17(28-2)18(14)29-11-10-22/h3-9,12H,11H2,1-2H3,(H,23,25,27)/b16-12+ |
| InChIKey | KFDRINNSGBQMOK-FOWTUZBSSA-N |
| XLogP | 2.57 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|