About 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol
1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 60908593) has the molecular formula C11H18N4O5S
and a molecular weight of 318.36 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| PubChem CID | 60908593 |
| Molecular Formula | C11H18N4O5S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CNC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C11H18N4O5S/c16-11(8-14-7-10(5-13-14)15(17)18)6-12-9-1-3-21(19,20)4-2-9/h5,7,9,11-12,16H,1-4,6,8H2 |
| InChIKey | ONRJWWSCBDTYMD-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol?
The IUPAC name of 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol (CID 60908593) is 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol.
What is the SMILES notation for 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol?
The canonical SMILES for 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol is O=[N+]([O-])c1cnn(CC(O)CNC2CCS(=O)(=O)CC2)c1.
What is the InChIKey of 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol?
The InChIKey is ONRJWWSCBDTYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O5S/c16-11(8-14-7-10(5-13-14)15(17)18)6-12-9-1-3-21(19,20)4-2-9/h5,7,9,11-12,16H,1-4,6,8H2.
What are the key properties of 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol?
1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol has a molecular weight of 318.36 g/mol, XLogP of -0.68, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxothian-4-yl)amino]-3-(4-nitropyrazol-1-yl)propan-2-ol is sourced from PubChem (CID 60908593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).