About 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide
3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide (PubChem CID 60910117) has the molecular formula C7H16N2O4S2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide |
| PubChem CID | 60910117 |
| Molecular Formula | C7H16N2O4S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide |
| SMILES | NCCCS(=O)(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H16N2O4S2/c8-3-1-4-15(12,13)9-7-2-5-14(10,11)6-7/h7,9H,1-6,8H2 |
| InChIKey | OAXQIZZCMBTZPG-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide?
The IUPAC name of 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide (CID 60910117) is 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide.
What is the SMILES notation for 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide?
The canonical SMILES for 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide is NCCCS(=O)(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide?
The InChIKey is OAXQIZZCMBTZPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O4S2/c8-3-1-4-15(12,13)9-7-2-5-14(10,11)6-7/h7,9H,1-6,8H2.
What are the key properties of 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide?
3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide has a molecular weight of 256.35 g/mol, XLogP of -1.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(1,1-dioxothiolan-3-yl)propane-1-sulfonamide is sourced from PubChem (CID 60910117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).