C10H23N3O2S — CID 60910513
3-amino-N-[(1-ethylpyrrolidin-3-yl)methyl]propane-1-sulfonamide (PubChem CID 60910513) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-amino-N-[(1-ethylpyrrolidin-3-yl)methyl]propane-1-sulfonamide.
| Compound Name | 3-amino-N-[(1-ethylpyrrolidin-3-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 60910513 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-amino-N-[(1-ethylpyrrolidin-3-yl)methyl]propane-1-sulfonamide |
| SMILES | CCN1CCC(CNS(=O)(=O)CCCN)C1 |
| InChI | InChI=1S/C10H23N3O2S/c1-2-13-6-4-10(9-13)8-12-16(14,15)7-3-5-11/h10,12H,2-9,11H2,1H3 |
| InChIKey | YFRFZWRGTDJWBZ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |