C9H11N5 — CID 60910683
1-(2-pyridin-2-ylethyl)-1,2,4-triazol-3-amine (PubChem CID 60910683) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylethyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(2-pyridin-2-ylethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 60910683 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-(2-pyridin-2-ylethyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(CCc2ccccn2)n1 |
| InChI | InChI=1S/C9H11N5/c10-9-12-7-14(13-9)6-4-8-3-1-2-5-11-8/h1-3,5,7H,4,6H2,(H2,10,13) |
| InChIKey | RXKDYVZJJUUTNR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |