About 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide
2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide (PubChem CID 60910688) has the molecular formula C7H13N5O
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide.
Molecular Properties
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide |
| PubChem CID | 60910688 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)n1cnc(N)n1 |
| InChI | InChI=1S/C7H13N5O/c1-3-9-6(13)5(2)12-4-10-7(8)11-12/h4-5H,3H2,1-2H3,(H2,8,11)(H,9,13) |
| InChIKey | GTAQQVCIUBQBFO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide?
The IUPAC name of 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide (CID 60910688) is 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide.
What is the SMILES notation for 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide?
The canonical SMILES for 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide is CCNC(=O)C(C)n1cnc(N)n1.
What is the InChIKey of 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide?
The InChIKey is GTAQQVCIUBQBFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5O/c1-3-9-6(13)5(2)12-4-10-7(8)11-12/h4-5H,3H2,1-2H3,(H2,8,11)(H,9,13).
What are the key properties of 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide?
2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide has a molecular weight of 183.21 g/mol, XLogP of -0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1,2,4-triazol-1-yl)-N-ethylpropanamide is sourced from PubChem (CID 60910688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).