About 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide
5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 60911341) has the molecular formula C8H10N4O3S
and a molecular weight of 242.26 g/mol. Its IUPAC name is 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 60911341 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cn[nH]c2C)on1 |
| InChI | InChI=1S/C8H10N4O3S/c1-5-3-8(15-11-5)12-16(13,14)7-4-9-10-6(7)2/h3-4,12H,1-2H3,(H,9,10) |
| InChIKey | NQBXUURJUGNPDP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide (CID 60911341) is 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide is Cc1cc(NS(=O)(=O)c2cn[nH]c2C)on1.
What is the InChIKey of 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide?
The InChIKey is NQBXUURJUGNPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3S/c1-5-3-8(15-11-5)12-16(13,14)7-4-9-10-6(7)2/h3-4,12H,1-2H3,(H,9,10).
What are the key properties of 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide?
5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide has a molecular weight of 242.26 g/mol, XLogP of 0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(3-methyl-1,2-oxazol-5-yl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 60911341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).