About 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine
1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine (PubChem CID 60911456) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine |
| PubChem CID | 60911456 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine |
| SMILES | COc1ccc(Cn2cnc(N)n2)cc1 |
| InChI | InChI=1S/C10H12N4O/c1-15-9-4-2-8(3-5-9)6-14-7-12-10(11)13-14/h2-5,7H,6H2,1H3,(H2,11,13) |
| InChIKey | JKYAJSICINMAJG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine?
The IUPAC name of 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine (CID 60911456) is 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine?
The canonical SMILES for 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine is COc1ccc(Cn2cnc(N)n2)cc1.
What is the InChIKey of 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine?
The InChIKey is JKYAJSICINMAJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-15-9-4-2-8(3-5-9)6-14-7-12-10(11)13-14/h2-5,7H,6H2,1H3,(H2,11,13).
What are the key properties of 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine?
1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine has a molecular weight of 204.23 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-amine is sourced from PubChem (CID 60911456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).