About 1-propan-2-yl-1,2,4-triazol-3-amine
1-propan-2-yl-1,2,4-triazol-3-amine (PubChem CID 60912203) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-propan-2-yl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-propan-2-yl-1,2,4-triazol-3-amine |
| PubChem CID | 60912203 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 1-propan-2-yl-1,2,4-triazol-3-amine |
| SMILES | CC(C)n1cnc(N)n1 |
| InChI | InChI=1S/C5H10N4/c1-4(2)9-3-7-5(6)8-9/h3-4H,1-2H3,(H2,6,8) |
| InChIKey | MYXSAVAFEFCDKG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-propan-2-yl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-1,2,4-triazol-3-amine?
The IUPAC name of 1-propan-2-yl-1,2,4-triazol-3-amine (CID 60912203) is 1-propan-2-yl-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-propan-2-yl-1,2,4-triazol-3-amine?
The canonical SMILES for 1-propan-2-yl-1,2,4-triazol-3-amine is CC(C)n1cnc(N)n1.
What is the InChIKey of 1-propan-2-yl-1,2,4-triazol-3-amine?
The InChIKey is MYXSAVAFEFCDKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4/c1-4(2)9-3-7-5(6)8-9/h3-4H,1-2H3,(H2,6,8).
What are the key properties of 1-propan-2-yl-1,2,4-triazol-3-amine?
1-propan-2-yl-1,2,4-triazol-3-amine has a molecular weight of 126.16 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-1,2,4-triazol-3-amine is sourced from PubChem (CID 60912203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).