C8H13N3S2 — CID 60913514
3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]butanimidamide (PubChem CID 60913514) has the molecular formula C8H13N3S2 and a molecular weight of 215.35 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]butanimidamide.
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]butanimidamide |
|---|---|
| PubChem CID | 60913514 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)Sc1nc(C)cs1 |
| InChI | InChI=1S/C8H13N3S2/c1-5-4-12-8(11-5)13-6(2)3-7(9)10/h4,6H,3H2,1-2H3,(H3,9,10) |
| InChIKey | ZHHXRKNNZVVANH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|