C13H24N2S — CID 60915057
3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanethioamide (PubChem CID 60915057) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanethioamide.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanethioamide |
|---|---|
| PubChem CID | 60915057 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butanethioamide |
| SMILES | CC(CC(N)=S)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C13H24N2S/c1-10(8-13(14)16)15-7-6-11-4-2-3-5-12(11)9-15/h10-12H,2-9H2,1H3,(H2,14,16) |
| InChIKey | YFWXYVDTRAFMOR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|