C24H18ClNO3 — CID 6091516
(4Z)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one (PubChem CID 6091516) has the molecular formula C24H18ClNO3 and a molecular weight of 403.87 g/mol. Its IUPAC name is (4Z)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6091516 |
| Molecular Formula | C24H18ClNO3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (4Z)-4-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccccc1C1=N/C(=C\c2cccc(OCc3ccccc3Cl)c2)C(=O)O1 |
| InChI | InChI=1S/C24H18ClNO3/c1-16-7-2-4-11-20(16)23-26-22(24(27)29-23)14-17-8-6-10-19(13-17)28-15-18-9-3-5-12-21(18)25/h2-14H,15H2,1H3/b22-14- |
| InChIKey | JYKAKFGENFIGRN-HMAPJEAMSA-N |
| XLogP | 5.57 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|