C13H20N4O2 — CID 60915525
6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 60915525) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60915525 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 6-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(CN2CC3CNCC3C2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H20N4O2/c1-15-11(3-12(18)16(2)13(15)19)8-17-6-9-4-14-5-10(9)7-17/h3,9-10,14H,4-8H2,1-2H3 |
| InChIKey | ZBUIKUPZWOZBAI-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |