C8H16N2O3S — CID 60915783
N-cyclopropyl-2-(2-methylsulfonylethylamino)acetamide (PubChem CID 60915783) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is N-cyclopropyl-2-(2-methylsulfonylethylamino)acetamide.
| Compound Name | N-cyclopropyl-2-(2-methylsulfonylethylamino)acetamide |
|---|---|
| PubChem CID | 60915783 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | N-cyclopropyl-2-(2-methylsulfonylethylamino)acetamide |
| SMILES | CS(=O)(=O)CCNCC(=O)NC1CC1 |
| InChI | InChI=1S/C8H16N2O3S/c1-14(12,13)5-4-9-6-8(11)10-7-2-3-7/h7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | PVYCGGSPSVELGE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|