C15H17BrN4O — CID 60916558
5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-3-(3-bromophenyl)-1,2,4-oxadiazole (PubChem CID 60916558) has the molecular formula C15H17BrN4O and a molecular weight of 349.23 g/mol. Its IUPAC name is 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-3-(3-bromophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-3-(3-bromophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 60916558 |
| Molecular Formula | C15H17BrN4O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-3-(3-bromophenyl)-1,2,4-oxadiazole |
| SMILES | Brc1cccc(-c2noc(CN3CC4CNCC4C3)n2)c1 |
| InChI | InChI=1S/C15H17BrN4O/c16-13-3-1-2-10(4-13)15-18-14(21-19-15)9-20-7-11-5-17-6-12(11)8-20/h1-4,11-12,17H,5-9H2 |
| InChIKey | AQDSCYULALJBTF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |