C11H9NO4 — CID 609171
7-ethyl-[1,3]dioxolo[4,5-e]isoindole-6,8-dione (PubChem CID 609171) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 7-ethyl-[1,3]dioxolo[4,5-e]isoindole-6,8-dione.
| Compound Name | 7-ethyl-[1,3]dioxolo[4,5-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 609171 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 7-ethyl-[1,3]dioxolo[4,5-e]isoindole-6,8-dione |
| SMILES | CCN1C(=O)c2ccc3c(c2C1=O)OCO3 |
| InChI | InChI=1S/C11H9NO4/c1-2-12-10(13)6-3-4-7-9(16-5-15-7)8(6)11(12)14/h3-4H,2,5H2,1H3 |
| InChIKey | WWSFCGJEAWVJMY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|