C6H8F3N3O2S — CID 60917319
N-methyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60917319) has the molecular formula C6H8F3N3O2S and a molecular weight of 243.21 g/mol. Its IUPAC name is N-methyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-methyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60917319 |
| Molecular Formula | C6H8F3N3O2S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N-methyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C6H8F3N3O2S/c1-12(4-6(7,8)9)15(13,14)5-2-10-11-3-5/h2-3H,4H2,1H3,(H,10,11) |
| InChIKey | OKUISTJLUKSAAU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |