C14H17N3O — CID 60917403
2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-benzoxazole (PubChem CID 60917403) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-benzoxazole.
| Compound Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 60917403 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-1,3-benzoxazole |
| SMILES | c1ccc2oc(CN3CC4CNCC4C3)nc2c1 |
| InChI | InChI=1S/C14H17N3O/c1-2-4-13-12(3-1)16-14(18-13)9-17-7-10-5-15-6-11(10)8-17/h1-4,10-11,15H,5-9H2 |
| InChIKey | PXZDAPVKMPYEEZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |