C12H10N4O4S — CID 60917739
5-[(4-cyanophenyl)methylsulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 60917739) has the molecular formula C12H10N4O4S and a molecular weight of 306.30 g/mol. Its IUPAC name is 5-[(4-cyanophenyl)methylsulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[(4-cyanophenyl)methylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 60917739 |
| Molecular Formula | C12H10N4O4S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-[(4-cyanophenyl)methylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | N#Cc1ccc(CNS(=O)(=O)c2[nH]ncc2C(=O)O)cc1 |
| InChI | InChI=1S/C12H10N4O4S/c13-5-8-1-3-9(4-2-8)6-15-21(19,20)11-10(12(17)18)7-14-16-11/h1-4,7,15H,6H2,(H,14,16)(H,17,18) |
| InChIKey | ZJWVPRLVOZHPGQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |