C9H8N4O2 — CID 609180
9-methyl-3-oxido-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium (PubChem CID 609180) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 9-methyl-3-oxido-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium.
| Compound Name | 9-methyl-3-oxido-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium |
|---|---|
| PubChem CID | 609180 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 9-methyl-3-oxido-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium |
| SMILES | Cc1cnnc2c1-c1no[n+]([O-])c1CC2 |
| InChI | InChI=1S/C9H8N4O2/c1-5-4-10-11-6-2-3-7-9(8(5)6)12-15-13(7)14/h4H,2-3H2,1H3 |
| InChIKey | RZSNSTKJTJPAEV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|