C11H18N4O3S3 — CID 60919761
2-amino-4-[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]sulfanylbutanoic acid (PubChem CID 60919761) has the molecular formula C11H18N4O3S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-amino-4-[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 60919761 |
| Molecular Formula | C11H18N4O3S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-amino-4-[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]sulfanylbutanoic acid |
| SMILES | CCCSc1nsc(NC(=O)CSCCC(N)C(=O)O)n1 |
| InChI | InChI=1S/C11H18N4O3S3/c1-2-4-20-11-14-10(21-15-11)13-8(16)6-19-5-3-7(12)9(17)18/h7H,2-6,12H2,1H3,(H,17,18)(H,13,14,15,16) |
| InChIKey | VNFOLAFRZRZFNK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|