C10H8FN5S — CID 60919771
[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine (PubChem CID 60919771) has the molecular formula C10H8FN5S and a molecular weight of 249.27 g/mol. Its IUPAC name is [6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine.
| Compound Name | [6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 60919771 |
| Molecular Formula | C10H8FN5S |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | [6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine |
| SMILES | NNc1nn2cc(-c3ccc(F)cc3)nc2s1 |
| InChI | InChI=1S/C10H8FN5S/c11-7-3-1-6(2-4-7)8-5-16-10(13-8)17-9(14-12)15-16/h1-5H,12H2,(H,14,15) |
| InChIKey | OIBARGGAURHUIP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|