C18H42O6Si4 — CID 609198
1,3,4,6-tetrakis(trimethylsilyloxy)hexane-2,5-dione (PubChem CID 609198) has the molecular formula C18H42O6Si4 and a molecular weight of 466.87 g/mol. Its IUPAC name is 1,3,4,6-tetrakis(trimethylsilyloxy)hexane-2,5-dione.
| Compound Name | 1,3,4,6-tetrakis(trimethylsilyloxy)hexane-2,5-dione |
|---|---|
| PubChem CID | 609198 |
| Molecular Formula | C18H42O6Si4 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 1,3,4,6-tetrakis(trimethylsilyloxy)hexane-2,5-dione |
| SMILES | C[Si](C)(C)OCC(=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C |
| InChI | InChI=1S/C18H42O6Si4/c1-25(2,3)21-13-15(19)17(23-27(7,8)9)18(24-28(10,11)12)16(20)14-22-26(4,5)6/h17-18H,13-14H2,1-12H3 |
| InChIKey | QQAPFRRDUDTDDM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|