C12H15Cl2NO — CID 60920110
N-[(2,3-dichlorophenyl)methyl]-1-(oxolan-3-yl)methanamine (PubChem CID 60920110) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-1-(oxolan-3-yl)methanamine.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-1-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 60920110 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-1-(oxolan-3-yl)methanamine |
| SMILES | Clc1cccc(CNCC2CCOC2)c1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c13-11-3-1-2-10(12(11)14)7-15-6-9-4-5-16-8-9/h1-3,9,15H,4-8H2 |
| InChIKey | SBQJAQGHVOCTOJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |