C14H20N2O4S — CID 60920196
2-amino-4-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 60920196) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-amino-4-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 60920196 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-amino-4-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | CCOc1ccccc1NC(=O)CSCCC(N)C(=O)O |
| InChI | InChI=1S/C14H20N2O4S/c1-2-20-12-6-4-3-5-11(12)16-13(17)9-21-8-7-10(15)14(18)19/h3-6,10H,2,7-9,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | BCXIFSHEYWAHIZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|