C23H44O8SSi3 — CID 609207
[6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 609207) has the molecular formula C23H44O8SSi3 and a molecular weight of 564.92 g/mol. Its IUPAC name is [6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 609207 |
| Molecular Formula | C23H44O8SSi3 |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COC1OC(COS(=O)(=O)c2ccc(C)cc2)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C23H44O8SSi3/c1-17-12-14-18(15-13-17)32(24,25)27-16-19-20(29-33(3,4)5)21(30-34(6,7)8)22(23(26-2)28-19)31-35(9,10)11/h12-15,19-23H,16H2,1-11H3 |
| InChIKey | SFGDJVWEPZEJKT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|