C25H62O7Si6 — CID 609209
1,3,4,5,6,7-hexakis(trimethylsilyloxy)heptan-2-one (PubChem CID 609209) has the molecular formula C25H62O7Si6 and a molecular weight of 643.28 g/mol. Its IUPAC name is 1,3,4,5,6,7-hexakis(trimethylsilyloxy)heptan-2-one.
| Compound Name | 1,3,4,5,6,7-hexakis(trimethylsilyloxy)heptan-2-one |
|---|---|
| PubChem CID | 609209 |
| Molecular Formula | C25H62O7Si6 |
| Molecular Weight | 643.28 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | 1,3,4,5,6,7-hexakis(trimethylsilyloxy)heptan-2-one |
| SMILES | C[Si](C)(C)OCC(=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H62O7Si6/c1-33(2,3)27-19-21(26)23(30-36(10,11)12)25(32-38(16,17)18)24(31-37(13,14)15)22(29-35(7,8)9)20-28-34(4,5)6/h22-25H,19-20H2,1-18H3 |
| InChIKey | YPWQROLNAURUHV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.28 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|