C25H50O8SSi4 — CID 609210
[3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 609210) has the molecular formula C25H50O8SSi4 and a molecular weight of 623.08 g/mol. Its IUPAC name is [3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 609210 |
| Molecular Formula | C25H50O8SSi4 |
| Molecular Weight | 623.08 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | [3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C25H50O8SSi4/c1-19-14-16-20(17-15-19)34(26,27)28-18-21-22(30-35(2,3)4)23(31-36(5,6)7)24(32-37(8,9)10)25(29-21)33-38(11,12)13/h14-17,21-25H,18H2,1-13H3 |
| InChIKey | ZFGBRGPBOHDDJG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|