About 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine
3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine (PubChem CID 60921363) has the molecular formula C10H21F2N3
and a molecular weight of 221.29 g/mol. Its IUPAC name is 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine |
| PubChem CID | 60921363 |
| Molecular Formula | C10H21F2N3 |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.17 |
| IUPAC Name | 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine |
| SMILES | CC(CN)CN1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C10H21F2N3/c1-9(6-13)7-14-2-4-15(5-3-14)8-10(11)12/h9-10H,2-8,13H2,1H3 |
| InChIKey | NQGDCAQTJARMKJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine?
The IUPAC name of 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine (CID 60921363) is 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine.
What is the SMILES notation for 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine?
The canonical SMILES for 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine is CC(CN)CN1CCN(CC(F)F)CC1.
What is the InChIKey of 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine?
The InChIKey is NQGDCAQTJARMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F2N3/c1-9(6-13)7-14-2-4-15(5-3-14)8-10(11)12/h9-10H,2-8,13H2,1H3.
What are the key properties of 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine?
3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine has a molecular weight of 221.29 g/mol, XLogP of 0.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 60921363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).