About 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline
4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline (PubChem CID 60921488) has the molecular formula C10H12BrF2N
and a molecular weight of 264.11 g/mol. Its IUPAC name is 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline |
| PubChem CID | 60921488 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1NCC(F)F |
| InChI | InChI=1S/C10H12BrF2N/c1-6-3-8(11)4-7(2)10(6)14-5-9(12)13/h3-4,9,14H,5H2,1-2H3 |
| InChIKey | CTQGARNFPUPOFX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline?
The IUPAC name of 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline (CID 60921488) is 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline.
What is the SMILES notation for 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline?
The canonical SMILES for 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline is Cc1cc(Br)cc(C)c1NCC(F)F.
What is the InChIKey of 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline?
The InChIKey is CTQGARNFPUPOFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrF2N/c1-6-3-8(11)4-7(2)10(6)14-5-9(12)13/h3-4,9,14H,5H2,1-2H3.
What are the key properties of 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline?
4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline has a molecular weight of 264.11 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(2,2-difluoroethyl)-2,6-dimethylaniline is sourced from PubChem (CID 60921488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).